* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-10-5895 |
| English Synonyms: | ABBYPHARMA AP-10-5895 |
| MDL Number.: | MFCD16988532 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)(Cc1cccnc1)C(=O)O.Cl |
| InChi: | InChI=1S/C10H13NO2.ClH/c1-10(2,9(12)13)6-8-4-3-5-11-7-8;/h3-5,7H,6H2,1-2H3,(H,12,13);1H |
| InChiKey: | InChIKey=CDIJBHNOWTYMJX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.