* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABBYPHARMA AP-10-5896 |
English Synonyms: | ABBYPHARMA AP-10-5896 |
MDL Number.: | MFCD16988533 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)(Cc1ccccn1)C(=O)O.Cl |
InChi: | InChI=1S/C10H13NO2.ClH/c1-10(2,9(12)13)7-8-5-3-4-6-11-8;/h3-6H,7H2,1-2H3,(H,12,13);1H |
InChiKey: | InChIKey=QNPADWWUYAALIV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.