* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-5969 |
English Synonyms: | ABBYPHARMA AP-10-5969 |
MDL Number.: | MFCD16988541 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(=Cc1cc(cnc1N)C(F)(F)F)C |
InChi: | InChI=1S/C10H11F3N2/c1-6(2)3-7-4-8(10(11,12)13)5-15-9(7)14/h3-5H,1-2H3,(H2,14,15) |
InChiKey: | InChIKey=QUOCKTUWINOOHJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.