* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-5142 |
English Synonyms: | ABBYPHARMA AP-11-5142 |
MDL Number.: | MFCD16988548 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cnccc1[C@H]2CC(=O)CC[C@@H]2C(=O)O |
InChi: | InChI=1S/C12H13NO3/c14-9-1-2-10(12(15)16)11(7-9)8-3-5-13-6-4-8/h3-6,10-11H,1-2,7H2,(H,15,16)/t10-,11+/m0/s1 |
InChiKey: | InChIKey=KOKLQBQZRPAGJO-WDEREUQCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.