* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-11-5445 |
| English Synonyms: | ABBYPHARMA AP-11-5445 |
| MDL Number.: | MFCD16988562 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CS(=O)(=O)c1ccc(cn1)NN.Cl |
| InChi: | InChI=1S/C6H9N3O2S.ClH/c1-12(10,11)6-3-2-5(9-7)4-8-6;/h2-4,9H,7H2,1H3;1H |
| InChiKey: | InChIKey=UGSNJXVFJLZSBY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.