* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-5555 |
English Synonyms: | ABBYPHARMA AP-11-5555 |
MDL Number.: | MFCD16988569 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(C)(c1ccncc1)N.C(=O)(C(=O)O)O |
InChi: | InChI=1S/C8H12N2.C2H2O4/c1-8(2,9)7-3-5-10-6-4-7;3-1(4)2(5)6/h3-6H,9H2,1-2H3;(H,3,4)(H,5,6) |
InChiKey: | InChIKey=VRYGBMNKUPRJHB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.