* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-5635 |
English Synonyms: | ABBYPHARMA AP-11-5635 |
MDL Number.: | MFCD16988573 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1cnccc1C(C#N)N2CC=CCCC2=O |
InChi: | InChI=1S/C13H13N3O/c14-10-12(11-5-7-15-8-6-11)16-9-3-1-2-4-13(16)17/h1,3,5-8,12H,2,4,9H2 |
InChiKey: | InChIKey=LXHKZRQAJQADRW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.