* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-5636 |
English Synonyms: | ABBYPHARMA AP-11-5636 |
MDL Number.: | MFCD16988574 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1cc(cnc1)C(C#N)N2CC=CCCC2=O |
InChi: | InChI=1S/C13H13N3O/c14-9-12(11-5-4-7-15-10-11)16-8-3-1-2-6-13(16)17/h1,3-5,7,10,12H,2,6,8H2 |
InChiKey: | InChIKey=GAHRUGWWKMZGDN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.