* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-5753 |
English Synonyms: | ABBYPHARMA AP-11-5753 |
MDL Number.: | MFCD16988578 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)CCOc2cccc(n2)NN |
InChi: | InChI=1S/C13H15N3O/c14-16-12-7-4-8-13(15-12)17-10-9-11-5-2-1-3-6-11/h1-8H,9-10,14H2,(H,15,16) |
InChiKey: | InChIKey=ISBAJECSAFEUHF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.