* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-5759 |
English Synonyms: | ALPHACHIRON 25876B667 ; ABBYPHARMA AP-11-5759 |
MDL Number.: | MFCD16988579 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | B(c1ccnc(c1C2OCCO2)Cl)(O)O |
InChi: | InChI=1S/C8H9BClNO4/c10-7-6(8-14-3-4-15-8)5(9(12)13)1-2-11-7/h1-2,8,12-13H,3-4H2 |
InChiKey: | InChIKey=ABFMCIJUERQIJO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.