* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-11-5764 |
| English Synonyms: | ABBYPHARMA AP-11-5764 |
| MDL Number.: | MFCD16988580 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cnc(cc1CN)N2CCOCC2.Cl |
| InChi: | InChI=1S/C10H15N3O.ClH/c11-8-9-1-2-12-10(7-9)13-3-5-14-6-4-13;/h1-2,7H,3-6,8,11H2;1H |
| InChiKey: | InChIKey=USSOZHOIZRNWOI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.