* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-5862 |
English Synonyms: | ABBYPHARMA AP-11-5862 |
MDL Number.: | MFCD16988593 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(nc(c1)Cl)C2=CCNCC2.Cl |
InChi: | InChI=1S/C10H11ClN2.ClH/c11-10-3-1-2-9(13-10)8-4-6-12-7-5-8;/h1-4,12H,5-7H2;1H |
InChiKey: | InChIKey=YFEODRYLGVDDDC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.