* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-5912 |
English Synonyms: | ABBYPHARMA AP-11-5912 |
MDL Number.: | MFCD16988595 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1cc[n+](cc1)C2CCCCC2Cl.[Cl-] |
InChi: | InChI=1S/C11H15ClN.ClH/c12-10-6-2-3-7-11(10)13-8-4-1-5-9-13;/h1,4-5,8-11H,2-3,6-7H2;1H/q+1;/p-1 |
InChiKey: | InChIKey=UWJHVRNLYJVLCC-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.