* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-5963 |
English Synonyms: | ABBYPHARMA AP-11-5963 |
MDL Number.: | MFCD16988596 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1c(cnc(c1F)CN)Cl.Cl.Cl |
InChi: | InChI=1S/C6H6ClFN2.2ClH/c7-4-1-5(8)6(2-9)10-3-4;;/h1,3H,2,9H2;2*1H |
InChiKey: | InChIKey=ZKJOVSAFZGRHOY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.