* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-12-5203 |
English Synonyms: | ABBYPHARMA AP-12-5203 |
MDL Number.: | MFCD16988607 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1cc(ncc1NC(=O)OC(C)(C)C)OC |
InChi: | InChI=1S/C12H18N2O3/c1-8-6-10(16-5)13-7-9(8)14-11(15)17-12(2,3)4/h6-7H,1-5H3,(H,14,15) |
InChiKey: | InChIKey=ZUTGOBZDHFXKHW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.