* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-12-5325 |
English Synonyms: | ABBYPHARMA AP-12-5325 |
MDL Number.: | MFCD16988611 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1ccnc(c1)CNC[C@@H]2CCC(=O)N2.Cl |
InChi: | InChI=1S/C11H15N3O.ClH/c15-11-5-4-10(14-11)8-12-7-9-3-1-2-6-13-9;/h1-3,6,10,12H,4-5,7-8H2,(H,14,15);1H/t10-;/m0./s1 |
InChiKey: | InChIKey=HTEPFKQCUXQSPV-PPHPATTJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.