* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABBYPHARMA AP-12-5433 |
English Synonyms: | ALPHACHIRON 25876B704 ; ABBYPHARMA AP-12-5433 |
MDL Number.: | MFCD16988616 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(nc2)CC#N |
InChi: | InChI=1S/C13H17BN2O2/c1-12(2)13(3,4)18-14(17-12)10-5-6-11(7-8-15)16-9-10/h5-6,9H,7H2,1-4H3 |
InChiKey: | InChIKey=NWTAOFNJRRLBFS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.