* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABBYPHARMA AP-12-5450 |
English Synonyms: | ABBYPHARMA AP-12-5450 |
MDL Number.: | MFCD16988617 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1c(cc(nc1CN)C(F)F)C(F)F.Cl |
InChi: | InChI=1S/C8H8F4N2.ClH/c9-7(10)4-1-5(3-13)14-6(2-4)8(11)12;/h1-2,7-8H,3,13H2;1H |
InChiKey: | InChIKey=AHBZMGBEBIOMTF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.