* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-12-5694 |
| English Synonyms: | ABBYPHARMA AP-12-5694 |
| MDL Number.: | MFCD16988628 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(C(=O)c1ccncc1)Br.Cl |
| InChi: | InChI=1S/C8H8BrNO.ClH/c1-6(9)8(11)7-2-4-10-5-3-7;/h2-6H,1H3;1H |
| InChiKey: | InChIKey=VVUUAOYFSWXVPQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.