* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABBYPHARMA AP-12-5796 |
English Synonyms: | ABBYPHARMA AP-12-5796 |
MDL Number.: | MFCD16988634 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC1(CC(=CC(=O)C1)Nc2ccncc2)C.Cl |
InChi: | InChI=1S/C13H16N2O.ClH/c1-13(2)8-11(7-12(16)9-13)15-10-3-5-14-6-4-10;/h3-7H,8-9H2,1-2H3,(H,14,15);1H |
InChiKey: | InChIKey=OKNHBMJNMXCYLX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.