* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-13-5105 |
English Synonyms: | ABBYPHARMA AP-13-5105 |
MDL Number.: | MFCD16988646 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccnc(c1)C2(CCC2)N.C(=O)(C(F)(F)F)O |
InChi: | InChI=1S/C9H12N2.C2HF3O2/c10-9(5-3-6-9)8-4-1-2-7-11-8;3-2(4,5)1(6)7/h1-2,4,7H,3,5-6,10H2;(H,6,7) |
InChiKey: | InChIKey=SGGHQEZMHPBOFB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.