* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABBYPHARMA AP-13-5228 |
English Synonyms: | ABBYPHARMA AP-13-5228 |
MDL Number.: | MFCD16988649 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cnccc1CC(=O)CO.C(=O)(C(F)(F)F)O |
InChi: | InChI=1S/C8H9NO2.C2HF3O2/c10-6-8(11)5-7-1-3-9-4-2-7;3-2(4,5)1(6)7/h1-4,10H,5-6H2;(H,6,7) |
InChiKey: | InChIKey=RDTWIHUJXMXWCN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.