* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-13-5258 |
| English Synonyms: | ABBYPHARMA AP-13-5258 |
| MDL Number.: | MFCD16988653 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cnccc1C(C(F)(F)F)N.C(=O)(C(=O)O)O |
| InChi: | InChI=1S/C7H7F3N2.C2H2O4/c8-7(9,10)6(11)5-1-3-12-4-2-5;3-1(4)2(5)6/h1-4,6H,11H2;(H,3,4)(H,5,6) |
| InChiKey: | InChIKey=QFORQCIHBRGTDJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.