* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABBYPHARMA AP-13-5347 |
English Synonyms: | ABBYPHARMA AP-13-5347 |
MDL Number.: | MFCD16988657 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cnccc1C2(CCNCC2)O.C(=O)(C(=O)O)O |
InChi: | InChI=1S/C10H14N2O.C2H2O4/c13-10(3-7-12-8-4-10)9-1-5-11-6-2-9;3-1(4)2(5)6/h1-2,5-6,12-13H,3-4,7-8H2;(H,3,4)(H,5,6) |
InChiKey: | InChIKey=FKXYRNFVIIETJL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.