* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-13-5559 |
English Synonyms: | ABBYPHARMA AP-13-5559 |
MDL Number.: | MFCD16988668 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1c(cncc1Br)S(=O)(=O)O.Cl |
InChi: | InChI=1S/C5H4BrNO3S.ClH/c6-4-1-5(3-7-2-4)11(8,9)10;/h1-3H,(H,8,9,10);1H |
InChiKey: | InChIKey=YUOFWSKIUUIZGV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.