* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-13-5632 |
| English Synonyms: | ABBYPHARMA AP-13-5632 |
| MDL Number.: | MFCD16988673 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)c2cnc(cc2C(=O)O)Br |
| InChi: | InChI=1S/C12H8BrNO2/c13-11-6-9(12(15)16)10(7-14-11)8-4-2-1-3-5-8/h1-7H,(H,15,16) |
| InChiKey: | InChIKey=PXURBLYOVARVHZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.