* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-13-5654 |
English Synonyms: | ABBYPHARMA AP-13-5654 |
MDL Number.: | MFCD16988676 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(cnc1)C(C(=O)O)N2CCCC2.Cl.Cl |
InChi: | InChI=1S/C11H14N2O2.2ClH/c14-11(15)10(13-6-1-2-7-13)9-4-3-5-12-8-9;;/h3-5,8,10H,1-2,6-7H2,(H,14,15);2*1H |
InChiKey: | InChIKey=VHOCRSIPVNXAOC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.