* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-13-5959 |
| English Synonyms: | ABBYPHARMA AP-13-5959 |
| MDL Number.: | MFCD16988686 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCC(CC1)(CO)c2ccccn2 |
| InChi: | InChI=1S/C16H24N2O3/c1-15(2,3)21-14(20)18-10-7-16(12-19,8-11-18)13-6-4-5-9-17-13/h4-6,9,19H,7-8,10-12H2,1-3H3 |
| InChiKey: | InChIKey=YKRZFQSNPXNJFO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.