* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-14-5206 |
English Synonyms: | ABBYPHARMA AP-14-5206 |
MDL Number.: | MFCD16988709 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | Cc1ccc(cn1)c2cc(cc(c2)C(F)(F)F)C(F)(F)F |
InChi: | InChI=1S/C14H9F6N/c1-8-2-3-9(7-21-8)10-4-11(13(15,16)17)6-12(5-10)14(18,19)20/h2-7H,1H3 |
InChiKey: | InChIKey=ZSUHTKOTWOAVFL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.