* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-14-5218 |
English Synonyms: | ABBYPHARMA AP-14-5218 |
MDL Number.: | MFCD16988710 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cnccc1CC2(CCNCC2)O.C(=O)(C(F)(F)F)O |
InChi: | InChI=1S/C11H16N2O.C2HF3O2/c14-11(3-7-13-8-4-11)9-10-1-5-12-6-2-10;3-2(4,5)1(6)7/h1-2,5-6,13-14H,3-4,7-9H2;(H,6,7) |
InChiKey: | InChIKey=HMSGKATVQOQMAS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.