* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-15-5845 |
English Synonyms: | ABBYPHARMA AP-15-5845 |
MDL Number.: | MFCD16988739 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)Oc1ccnc(c1)O |
InChi: | InChI=1S/C8H11NO2/c1-6(2)11-7-3-4-9-8(10)5-7/h3-6H,1-2H3,(H,9,10) |
InChiKey: | InChIKey=HRQGHRVKFJXYAA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.