* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-16-5178 |
English Synonyms: | ABBYPHARMA AP-16-5178 |
MDL Number.: | MFCD16988749 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cnc(cc1N)CO.Cl |
InChi: | InChI=1S/C6H8N2O.ClH/c7-5-1-2-8-6(3-5)4-9;/h1-3,9H,4H2,(H2,7,8);1H |
InChiKey: | InChIKey=CRKQGIUTVRMJEM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.