* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-16-5913 |
English Synonyms: | ABBYPHARMA AP-16-5913 |
MDL Number.: | MFCD16988763 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cncc2c1OCCN2.Cl |
InChi: | InChI=1S/C7H8N2O.ClH/c1-2-8-5-6-7(1)10-4-3-9-6;/h1-2,5,9H,3-4H2;1H |
InChiKey: | InChIKey=LSTSYQROBHAOKP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.