* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-17-5060 |
English Synonyms: | ABBYPHARMA AP-17-5060 |
MDL Number.: | MFCD16988772 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | c1cc(cnc1)C(=O)c2nnco2 |
InChi: | InChI=1S/C8H5N3O2/c12-7(8-11-10-5-13-8)6-2-1-3-9-4-6/h1-5H |
InChiKey: | InChIKey=BXZHEQQSIKRXPX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.