* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-17-5543 |
English Synonyms: | ABBYPHARMA AP-17-5543 |
MDL Number.: | MFCD16988789 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1c(cncc1N)N.Cl.Cl |
InChi: | InChI=1S/C5H7N3.2ClH/c6-4-1-5(7)3-8-2-4;;/h1-3H,6-7H2;2*1H |
InChiKey: | InChIKey=GACDDWMIIOFTGW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.