* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-CHLORO-3-(2-METHYLPROP-1-EN-1-YL)PYRIDIN-2-AMINE |
| English Synonyms: | ABBYPHARMA AP-17-5580 ; 6-CHLORO-3-(2-METHYLPROP-1-EN-1-YL)PYRIDIN-2-AMINE |
| MDL Number.: | MFCD16988790 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(=Cc1ccc(nc1N)Cl)C |
| InChi: | InChI=1S/C9H11ClN2/c1-6(2)5-7-3-4-8(10)12-9(7)11/h3-5H,1-2H3,(H2,11,12) |
| InChiKey: | InChIKey=AIIMUVAKWRTCKO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.