* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-17-5795 |
English Synonyms: | ABBYPHARMA AP-17-5795 |
MDL Number.: | MFCD16988800 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccn(c(=O)c1)Cc2ccncc2 |
InChi: | InChI=1S/C11H10N2O/c14-11-3-1-2-8-13(11)9-10-4-6-12-7-5-10/h1-8H,9H2 |
InChiKey: | InChIKey=VDLAIBPCRNDQLC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.