* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-17-5944 |
English Synonyms: | ABBYPHARMA AP-17-5944 |
MDL Number.: | MFCD16988802 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCCNc1ccc(cn1)N.Cl |
InChi: | InChI=1S/C8H13N3.ClH/c1-2-5-10-8-4-3-7(9)6-11-8;/h3-4,6H,2,5,9H2,1H3,(H,10,11);1H |
InChiKey: | InChIKey=WJLGTJUXFKOADM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.