* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-18-5124 |
English Synonyms: | ABBYPHARMA AP-18-5124 |
MDL Number.: | MFCD16988806 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1cc(ncc1C2CC2)Cl.Cl |
InChi: | InChI=1S/C8H8ClN.ClH/c9-8-4-3-7(5-10-8)6-1-2-6;/h3-6H,1-2H2;1H |
InChiKey: | InChIKey=HIWXPOTWCJCNNW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.