* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-18-5612 |
English Synonyms: | ABBYPHARMA AP-18-5612 |
MDL Number.: | MFCD16988816 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc(c(nc1)O)CN.Cl.Cl |
InChi: | InChI=1S/C6H8N2O.2ClH/c7-4-5-2-1-3-8-6(5)9;;/h1-3H,4,7H2,(H,8,9);2*1H |
InChiKey: | InChIKey=WODYJLHRQXZHIT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.