* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-18-5797 |
English Synonyms: | ABBYPHARMA AP-18-5797 |
MDL Number.: | MFCD16988821 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc(cnc1)C2CC2C(=O)O.Cl |
InChi: | InChI=1S/C9H9NO2.ClH/c11-9(12)8-4-7(8)6-2-1-3-10-5-6;/h1-3,5,7-8H,4H2,(H,11,12);1H |
InChiKey: | InChIKey=RPFDAIBMARWIIE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.