* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-18-5883 |
English Synonyms: | ABBYPHARMA AP-18-5883 |
MDL Number.: | MFCD16988823 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc(cnc1)C2(CCNC2)O.Cl |
InChi: | InChI=1S/C9H12N2O.ClH/c12-9(3-5-11-7-9)8-2-1-4-10-6-8;/h1-2,4,6,11-12H,3,5,7H2;1H |
InChiKey: | InChIKey=OMFYSULQVUJBSM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.