* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-6013 |
English Synonyms: | ABBYPHARMA AP-10-6013 |
MDL Number.: | MFCD16988827 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | OCC1=CSC(I)=N1 |
InChi: | InChI=1S/C4H4INOS/c5-4-6-3(1-7)2-8-4/h2,7H,1H2 |
InChiKey: | InChIKey=UIAPMDVQNFPBLD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.