* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-7497 |
English Synonyms: | ABBYPHARMA AP-10-7497 |
MDL Number.: | MFCD16988865 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CCOC1=C(Cl)OC(C)=N1 |
InChi: | InChI=1S/C6H8ClNO2/c1-3-9-6-5(7)10-4(2)8-6/h3H2,1-2H3 |
InChiKey: | InChIKey=ALBDXBXEFKIVRT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.