* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-7509 |
English Synonyms: | ABBYPHARMA AP-10-7509 |
MDL Number.: | MFCD16988876 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCOC1=C(CO)OC(C=O)=N1 |
InChi: | InChI=1S/C7H9NO4/c1-2-11-7-5(3-9)12-6(4-10)8-7/h4,9H,2-3H2,1H3 |
InChiKey: | InChIKey=GVJNKTWBEZACPC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.