* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-7510 |
English Synonyms: | ABBYPHARMA AP-10-7510 |
MDL Number.: | MFCD16988877 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCOC1=C(Cl)OC(C=O)=N1 |
InChi: | InChI=1S/C6H6ClNO3/c1-2-10-6-5(7)11-4(3-9)8-6/h3H,2H2,1H3 |
InChiKey: | InChIKey=YGKWKQVFTRJOLB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.