* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-7516 |
English Synonyms: | ABBYPHARMA AP-10-7516 |
MDL Number.: | MFCD16988883 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCOC1=C(CO)OC(N)=N1 |
InChi: | InChI=1S/C6H10N2O3/c1-2-10-5-4(3-9)11-6(7)8-5/h9H,2-3H2,1H3,(H2,7,8) |
InChiKey: | InChIKey=GPMJVBGDQKAVGN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.