* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-7766 |
English Synonyms: | ABBYPHARMA AP-10-7766 |
MDL Number.: | MFCD16989125 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | NC(=O)C1=C(N=C(CO)O1)C(O)=O |
InChi: | InChI=1S/C6H6N2O5/c7-5(10)4-3(6(11)12)8-2(1-9)13-4/h9H,1H2,(H2,7,10)(H,11,12) |
InChiKey: | InChIKey=AHRVEAYXEJYUNN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.