* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-7779 |
English Synonyms: | ABBYPHARMA AP-10-7779 |
MDL Number.: | MFCD16989138 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | NC(=O)C1=NC(C(O)=O)=C(O1)C(O)=O |
InChi: | InChI=1S/C6H4N2O6/c7-3(9)4-8-1(5(10)11)2(14-4)6(12)13/h(H2,7,9)(H,10,11)(H,12,13) |
InChiKey: | InChIKey=NSBPVLRNSHNLLK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.