* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-7792 |
English Synonyms: | ABBYPHARMA AP-10-7792 |
MDL Number.: | MFCD16989151 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | OC(=O)C1=C(CCl)OC(Cl)=N1 |
InChi: | InChI=1S/C5H3Cl2NO3/c6-1-2-3(4(9)10)8-5(7)11-2/h1H2,(H,9,10) |
InChiKey: | InChIKey=IVQWWSOXCLLIGR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.